C21H26F3N — CID 54246631
5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-2-fluoropent-2-enenitrile (PubChem CID 54246631) has the molecular formula C21H26F3N and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-2-fluoropent-2-enenitrile.
| Compound Name | 5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-2-fluoropent-2-enenitrile |
|---|---|
| PubChem CID | 54246631 |
| Molecular Formula | C21H26F3N |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]-2-fluoropent-2-enenitrile |
| SMILES | N#CC(F)=CCCC1CCC(CCCCc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H26F3N/c22-19(15-25)7-3-6-17-10-8-16(9-11-17)4-1-2-5-18-12-13-20(23)21(24)14-18/h7,12-14,16-17H,1-6,8-11H2 |
| InChIKey | QTSJZKHKANLZED-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|