C14H19F2N — CID 18187745
4-[3-(3,4-difluorophenyl)propyl]piperidine (PubChem CID 18187745) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[3-(3,4-difluorophenyl)propyl]piperidine.
| Compound Name | 4-[3-(3,4-difluorophenyl)propyl]piperidine |
|---|---|
| PubChem CID | 18187745 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[3-(3,4-difluorophenyl)propyl]piperidine |
| SMILES | Fc1ccc(CCCC2CCNCC2)cc1F |
| InChI | InChI=1S/C14H19F2N/c15-13-5-4-12(10-14(13)16)3-1-2-11-6-8-17-9-7-11/h4-5,10-11,17H,1-3,6-9H2 |
| InChIKey | SWSRXKZUCLUNJW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |