C14H20Cl3N — CID 3059025
4-[3-(3,4-dichlorophenyl)propyl]piperidine;hydrochloride (PubChem CID 3059025) has the molecular formula C14H20Cl3N and a molecular weight of 308.68 g/mol. Its IUPAC name is 4-[3-(3,4-dichlorophenyl)propyl]piperidine;hydrochloride.
| Compound Name | 4-[3-(3,4-dichlorophenyl)propyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 3059025 |
| Molecular Formula | C14H20Cl3N |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[3-(3,4-dichlorophenyl)propyl]piperidine;hydrochloride |
| SMILES | Cl.Clc1ccc(CCCC2CCNCC2)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N.ClH/c15-13-5-4-12(10-14(13)16)3-1-2-11-6-8-17-9-7-11;/h4-5,10-11,17H,1-3,6-9H2;1H |
| InChIKey | JTMHUBPTTSLQLD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |