C13H16Cl2 — CID 67484216
1,2-dichloro-4-(2-cyclopentylethyl)benzene (PubChem CID 67484216) has the molecular formula C13H16Cl2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 1,2-dichloro-4-(2-cyclopentylethyl)benzene.
| Compound Name | 1,2-dichloro-4-(2-cyclopentylethyl)benzene |
|---|---|
| PubChem CID | 67484216 |
| Molecular Formula | C13H16Cl2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1,2-dichloro-4-(2-cyclopentylethyl)benzene |
| SMILES | Clc1ccc(CCC2CCCC2)cc1Cl |
| InChI | InChI=1S/C13H16Cl2/c14-12-8-7-11(9-13(12)15)6-5-10-3-1-2-4-10/h7-10H,1-6H2 |
| InChIKey | CWQNIBJBRJMQQB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |