C18H28O2 — CID 91085338
4-(2-cyclohexylethyl)-1,2-diethoxybenzene (PubChem CID 91085338) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-(2-cyclohexylethyl)-1,2-diethoxybenzene.
| Compound Name | 4-(2-cyclohexylethyl)-1,2-diethoxybenzene |
|---|---|
| PubChem CID | 91085338 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 4-(2-cyclohexylethyl)-1,2-diethoxybenzene |
| SMILES | CCOc1ccc(CCC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C18H28O2/c1-3-19-17-13-12-16(14-18(17)20-4-2)11-10-15-8-6-5-7-9-15/h12-15H,3-11H2,1-2H3 |
| InChIKey | HBCXQBGLBJHMLI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |