C20H30N2O4 — CID 108504420
N'-cyclohexyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide (PubChem CID 108504420) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is N'-cyclohexyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108504420 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N'-cyclohexyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)NC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C20H30N2O4/c1-3-25-17-11-10-15(14-18(17)26-4-2)12-13-21-19(23)20(24)22-16-8-6-5-7-9-16/h10-11,14,16H,3-9,12-13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | URVATZXDCDBOEY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|