C21H32N2O4 — CID 108529732
N'-cycloheptyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide (PubChem CID 108529732) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is N'-cycloheptyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-cycloheptyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108529732 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N'-cycloheptyl-N-[2-(3,4-diethoxyphenyl)ethyl]oxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)NC2CCCCCC2)cc1OCC |
| InChI | InChI=1S/C21H32N2O4/c1-3-26-18-12-11-16(15-19(18)27-4-2)13-14-22-20(24)21(25)23-17-9-7-5-6-8-10-17/h11-12,15,17H,3-10,13-14H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YINOBGOALMAAHK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|