C18H28N2O2S — CID 17267900
1-cyclohexyl-3-[(3,4-diethoxyphenyl)methyl]thiourea (PubChem CID 17267900) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3,4-diethoxyphenyl)methyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[(3,4-diethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 17267900 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-cyclohexyl-3-[(3,4-diethoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccc(CNC(=S)NC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C18H28N2O2S/c1-3-21-16-11-10-14(12-17(16)22-4-2)13-19-18(23)20-15-8-6-5-7-9-15/h10-12,15H,3-9,13H2,1-2H3,(H2,19,20,23) |
| InChIKey | LHAIZMZWTXUCTB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|