C24H33N3O3 — CID 23632472
2-(cyclohexylamino)-N-[2-(3,4-diethoxyphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 23632472) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-[2-(3,4-diethoxyphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-[2-(3,4-diethoxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23632472 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-(cyclohexylamino)-N-[2-(3,4-diethoxyphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cccnc2NC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C24H33N3O3/c1-3-29-21-13-12-18(17-22(21)30-4-2)14-16-26-24(28)20-11-8-15-25-23(20)27-19-9-6-5-7-10-19/h8,11-13,15,17,19H,3-7,9-10,14,16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WCTFLORDXBYTDP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |