C24H29N3O3 — CID 46577690
N-[2-(3,4-diethoxyphenyl)ethyl]-5-ethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 46577690) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-5-ethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-5-ethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46577690 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-5-ethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cnn(-c3ccccc3)c2CC)cc1OCC |
| InChI | InChI=1S/C24H29N3O3/c1-4-21-20(17-26-27(21)19-10-8-7-9-11-19)24(28)25-15-14-18-12-13-22(29-5-2)23(16-18)30-6-3/h7-13,16-17H,4-6,14-15H2,1-3H3,(H,25,28) |
| InChIKey | CJBRZUXJETXCST-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |