C13H17Cl2N — CID 83261164
4-[(3,4-dichlorophenyl)methyl]azepane (PubChem CID 83261164) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]azepane.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]azepane |
|---|---|
| PubChem CID | 83261164 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]azepane |
| SMILES | Clc1ccc(CC2CCCNCC2)cc1Cl |
| InChI | InChI=1S/C13H17Cl2N/c14-12-4-3-11(9-13(12)15)8-10-2-1-6-16-7-5-10/h3-4,9-10,16H,1-2,5-8H2 |
| InChIKey | VXPACBZIKAZPOH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |