C16H25N — CID 82289413
4-[3-(3,4-dimethylphenyl)propyl]piperidine (PubChem CID 82289413) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenyl)propyl]piperidine.
| Compound Name | 4-[3-(3,4-dimethylphenyl)propyl]piperidine |
|---|---|
| PubChem CID | 82289413 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 4-[3-(3,4-dimethylphenyl)propyl]piperidine |
| SMILES | Cc1ccc(CCCC2CCNCC2)cc1C |
| InChI | InChI=1S/C16H25N/c1-13-6-7-16(12-14(13)2)5-3-4-15-8-10-17-11-9-15/h6-7,12,15,17H,3-5,8-11H2,1-2H3 |
| InChIKey | IKXHLWQWQDVAQE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |