C12H17F2N — CID 116925212
5-(3,4-difluorophenyl)-2-methylpentan-2-amine (PubChem CID 116925212) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-2-methylpentan-2-amine.
| Compound Name | 5-(3,4-difluorophenyl)-2-methylpentan-2-amine |
|---|---|
| PubChem CID | 116925212 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-(3,4-difluorophenyl)-2-methylpentan-2-amine |
| SMILES | CC(C)(N)CCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H17F2N/c1-12(2,15)7-3-4-9-5-6-10(13)11(14)8-9/h5-6,8H,3-4,7,15H2,1-2H3 |
| InChIKey | APGITPGTUVJMSH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |