C11H16F2N2 — CID 84752735
1-(3,4-difluorophenyl)-2-N',2-N'-dimethylpropane-2,2-diamine (PubChem CID 84752735) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-N',2-N'-dimethylpropane-2,2-diamine.
| Compound Name | 1-(3,4-difluorophenyl)-2-N',2-N'-dimethylpropane-2,2-diamine |
|---|---|
| PubChem CID | 84752735 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-N',2-N'-dimethylpropane-2,2-diamine |
| SMILES | CN(C)C(C)(N)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H16F2N2/c1-11(14,15(2)3)7-8-4-5-9(12)10(13)6-8/h4-6H,7,14H2,1-3H3 |
| InChIKey | HPCQOWGPXKEKSS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|