C11H13BrF2 — CID 57182682
4-(5-bromopentyl)-1,2-difluorobenzene (PubChem CID 57182682) has the molecular formula C11H13BrF2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 4-(5-bromopentyl)-1,2-difluorobenzene.
| Compound Name | 4-(5-bromopentyl)-1,2-difluorobenzene |
|---|---|
| PubChem CID | 57182682 |
| Molecular Formula | C11H13BrF2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 4-(5-bromopentyl)-1,2-difluorobenzene |
| SMILES | Fc1ccc(CCCCCBr)cc1F |
| InChI | InChI=1S/C11H13BrF2/c12-7-3-1-2-4-9-5-6-10(13)11(14)8-9/h5-6,8H,1-4,7H2 |
| InChIKey | SYSBBQPOXDDWGH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|