C12H13BrF2O — CID 106798827
6-bromo-1-(3,4-difluorophenyl)hexan-3-one (PubChem CID 106798827) has the molecular formula C12H13BrF2O and a molecular weight of 291.13 g/mol. Its IUPAC name is 6-bromo-1-(3,4-difluorophenyl)hexan-3-one.
| Compound Name | 6-bromo-1-(3,4-difluorophenyl)hexan-3-one |
|---|---|
| PubChem CID | 106798827 |
| Molecular Formula | C12H13BrF2O |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 6-bromo-1-(3,4-difluorophenyl)hexan-3-one |
| SMILES | O=C(CCCBr)CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13BrF2O/c13-7-1-2-10(16)5-3-9-4-6-11(14)12(15)8-9/h4,6,8H,1-3,5,7H2 |
| InChIKey | VUCKVKNFQDCXIS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|