C13H14F2O — CID 114974843
1-(3,4-difluorophenyl)hept-6-en-2-one (PubChem CID 114974843) has the molecular formula C13H14F2O and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)hept-6-en-2-one.
| Compound Name | 1-(3,4-difluorophenyl)hept-6-en-2-one |
|---|---|
| PubChem CID | 114974843 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)hept-6-en-2-one |
| SMILES | C=CCCCC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2O/c1-2-3-4-5-11(16)8-10-6-7-12(14)13(15)9-10/h2,6-7,9H,1,3-5,8H2 |
| InChIKey | IXFZOAAHPQPMBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|