C14H18F2O — CID 115795494
1-(3,4-difluorophenyl)-6-methylheptan-2-one (PubChem CID 115795494) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-6-methylheptan-2-one.
| Compound Name | 1-(3,4-difluorophenyl)-6-methylheptan-2-one |
|---|---|
| PubChem CID | 115795494 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-6-methylheptan-2-one |
| SMILES | CC(C)CCCC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2O/c1-10(2)4-3-5-12(17)8-11-6-7-13(15)14(16)9-11/h6-7,9-10H,3-5,8H2,1-2H3 |
| InChIKey | LGZHCGPJJXSHEX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |