C13H16F2O — CID 62619889
1-(3,5-difluorophenyl)-5-methylhexan-2-one (PubChem CID 62619889) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-5-methylhexan-2-one.
| Compound Name | 1-(3,5-difluorophenyl)-5-methylhexan-2-one |
|---|---|
| PubChem CID | 62619889 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(3,5-difluorophenyl)-5-methylhexan-2-one |
| SMILES | CC(C)CCC(=O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H16F2O/c1-9(2)3-4-13(16)7-10-5-11(14)8-12(15)6-10/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | WNBMAMJOPHCZON-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |