C12H12F2O3 — CID 63899481
methyl 5-(3,4-difluorophenyl)-4-oxopentanoate (PubChem CID 63899481) has the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. Its IUPAC name is methyl 5-(3,4-difluorophenyl)-4-oxopentanoate.
| Compound Name | methyl 5-(3,4-difluorophenyl)-4-oxopentanoate |
|---|---|
| PubChem CID | 63899481 |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 5-(3,4-difluorophenyl)-4-oxopentanoate |
| SMILES | COC(=O)CCC(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12F2O3/c1-17-12(16)5-3-9(15)6-8-2-4-10(13)11(14)7-8/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | VLHYSBYXOGGZMN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |