C17H14F4O3 — CID 141151688
1,5-bis(3,5-difluoro-4-hydroxyphenyl)pentan-3-one (PubChem CID 141151688) has the molecular formula C17H14F4O3 and a molecular weight of 342.29 g/mol. Its IUPAC name is 1,5-bis(3,5-difluoro-4-hydroxyphenyl)pentan-3-one.
| Compound Name | 1,5-bis(3,5-difluoro-4-hydroxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 141151688 |
| Molecular Formula | C17H14F4O3 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1,5-bis(3,5-difluoro-4-hydroxyphenyl)pentan-3-one |
| SMILES | O=C(CCc1cc(F)c(O)c(F)c1)CCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C17H14F4O3/c18-12-5-9(6-13(19)16(12)23)1-3-11(22)4-2-10-7-14(20)17(24)15(21)8-10/h5-8,23-24H,1-4H2 |
| InChIKey | SCCKGMIGAKUDCG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |