8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid

C14H18F2O3 — CID 70316080

IUPAC8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid
SMILESO=C(O)CCCCCCCc1cc(F)c(O)c(F)c1
InChIInChI=1S/C14H18F2O3/c15-11-8-10(9-12(16)14(11)19)6-4-2-1-3-5-7-13(17)18/h8-9,19H,1-7H2,(H,17,18)
InChIKeyIFKRGGGGYFDFGH-UHFFFAOYSA-N
MW272.29 g/mol
LogP3.64
Rot. Bonds8

About 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid

8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid (PubChem CID 70316080) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid.

Molecular Properties

Compound Name8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid
PubChem CID70316080
Molecular FormulaC14H18F2O3
Molecular Weight272.29 g/mol
Exact Mass272.12
IUPAC Name8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid
SMILESO=C(O)CCCCCCCc1cc(F)c(O)c(F)c1
InChIInChI=1S/C14H18F2O3/c15-11-8-10(9-12(16)14(11)19)6-4-2-1-3-5-7-13(17)18/h8-9,19H,1-7H2,(H,17,18)
InChIKeyIFKRGGGGYFDFGH-UHFFFAOYSA-N
XLogP3.64
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.29
LogP ≤ 53.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid?
The IUPAC name of 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid (CID 70316080) is 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid.
What is the SMILES notation for 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid?
The canonical SMILES for 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid is O=C(O)CCCCCCCc1cc(F)c(O)c(F)c1.
What is the InChIKey of 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid?
The InChIKey is IFKRGGGGYFDFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2O3/c15-11-8-10(9-12(16)14(11)19)6-4-2-1-3-5-7-13(17)18/h8-9,19H,1-7H2,(H,17,18).
What are the key properties of 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid?
8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid has a molecular weight of 272.29 g/mol, XLogP of 3.64, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid is sourced from PubChem (CID 70316080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).