C14H18F2O3 — CID 70316080
8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid (PubChem CID 70316080) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid.
| Compound Name | 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid |
|---|---|
| PubChem CID | 70316080 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 8-(3,5-difluoro-4-hydroxyphenyl)octanoic acid |
| SMILES | O=C(O)CCCCCCCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C14H18F2O3/c15-11-8-10(9-12(16)14(11)19)6-4-2-1-3-5-7-13(17)18/h8-9,19H,1-7H2,(H,17,18) |
| InChIKey | IFKRGGGGYFDFGH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|