C7H8ClF2NO — CID 10488096
(3,5-difluoro-4-hydroxyphenyl)methylazanium chloride (PubChem CID 10488096) has the molecular formula C7H8ClF2NO and a molecular weight of 195.60 g/mol. Its IUPAC name is (3,5-difluoro-4-hydroxyphenyl)methylazanium chloride.
| Compound Name | (3,5-difluoro-4-hydroxyphenyl)methylazanium chloride |
|---|---|
| PubChem CID | 10488096 |
| Molecular Formula | C7H8ClF2NO |
| Molecular Weight | 195.60 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | (3,5-difluoro-4-hydroxyphenyl)methylazanium chloride |
| SMILES | [Cl-].[NH3+]Cc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C7H7F2NO.ClH/c8-5-1-4(3-10)2-6(9)7(5)11;/h1-2,11H,3,10H2;1H |
| InChIKey | XOEPDSROAPOYDB-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.60 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |