C11H14F2N2O — CID 116843725
5-(3,4-difluorophenyl)pentanehydrazide (PubChem CID 116843725) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)pentanehydrazide.
| Compound Name | 5-(3,4-difluorophenyl)pentanehydrazide |
|---|---|
| PubChem CID | 116843725 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-(3,4-difluorophenyl)pentanehydrazide |
| SMILES | NNC(=O)CCCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O/c12-9-6-5-8(7-10(9)13)3-1-2-4-11(16)15-14/h5-7H,1-4,14H2,(H,15,16) |
| InChIKey | DAIWIZISKCMQPE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|