About 11-(3,4-difluorophenyl)undecanal
11-(3,4-difluorophenyl)undecanal (PubChem CID 123357909) has the molecular formula C17H24F2O
and a molecular weight of 282.37 g/mol. Its IUPAC name is 11-(3,4-difluorophenyl)undecanal.
Molecular Properties
| Compound Name | 11-(3,4-difluorophenyl)undecanal |
| PubChem CID | 123357909 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 11-(3,4-difluorophenyl)undecanal |
| SMILES | O=CCCCCCCCCCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H24F2O/c18-16-12-11-15(14-17(16)19)10-8-6-4-2-1-3-5-7-9-13-20/h11-14H,1-10H2 |
| InChIKey | OCDGBUATCJVVRV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-(3,4-difluorophenyl)undecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(3,4-difluorophenyl)undecanal?
The IUPAC name of 11-(3,4-difluorophenyl)undecanal (CID 123357909) is 11-(3,4-difluorophenyl)undecanal.
What is the SMILES notation for 11-(3,4-difluorophenyl)undecanal?
The canonical SMILES for 11-(3,4-difluorophenyl)undecanal is O=CCCCCCCCCCCc1ccc(F)c(F)c1.
What is the InChIKey of 11-(3,4-difluorophenyl)undecanal?
The InChIKey is OCDGBUATCJVVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2O/c18-16-12-11-15(14-17(16)19)10-8-6-4-2-1-3-5-7-9-13-20/h11-14H,1-10H2.
What are the key properties of 11-(3,4-difluorophenyl)undecanal?
11-(3,4-difluorophenyl)undecanal has a molecular weight of 282.37 g/mol, XLogP of 5.22, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(3,4-difluorophenyl)undecanal is sourced from PubChem (CID 123357909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).