About 6-(2,6-difluorophenyl)hexanal
6-(2,6-difluorophenyl)hexanal (PubChem CID 87065996) has the molecular formula C12H14F2O
and a molecular weight of 212.24 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)hexanal.
Molecular Properties
| Compound Name | 6-(2,6-difluorophenyl)hexanal |
| PubChem CID | 87065996 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 6-(2,6-difluorophenyl)hexanal |
| SMILES | O=CCCCCCc1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2O/c13-11-7-5-8-12(14)10(11)6-3-1-2-4-9-15/h5,7-9H,1-4,6H2 |
| InChIKey | LEZNLLDJJQCKKX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,6-difluorophenyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-difluorophenyl)hexanal?
The IUPAC name of 6-(2,6-difluorophenyl)hexanal (CID 87065996) is 6-(2,6-difluorophenyl)hexanal.
What is the SMILES notation for 6-(2,6-difluorophenyl)hexanal?
The canonical SMILES for 6-(2,6-difluorophenyl)hexanal is O=CCCCCCc1c(F)cccc1F.
What is the InChIKey of 6-(2,6-difluorophenyl)hexanal?
The InChIKey is LEZNLLDJJQCKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O/c13-11-7-5-8-12(14)10(11)6-3-1-2-4-9-15/h5,7-9H,1-4,6H2.
What are the key properties of 6-(2,6-difluorophenyl)hexanal?
6-(2,6-difluorophenyl)hexanal has a molecular weight of 212.24 g/mol, XLogP of 3.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-difluorophenyl)hexanal is sourced from PubChem (CID 87065996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).