C22H37F — CID 67729666
1-fluoro-2,3-dioctylbenzene (PubChem CID 67729666) has the molecular formula C22H37F and a molecular weight of 320.54 g/mol. Its IUPAC name is 1-fluoro-2,3-dioctylbenzene.
| Compound Name | 1-fluoro-2,3-dioctylbenzene |
|---|---|
| PubChem CID | 67729666 |
| Molecular Formula | C22H37F |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 1-fluoro-2,3-dioctylbenzene |
| SMILES | CCCCCCCCc1cccc(F)c1CCCCCCCC |
| InChI | InChI=1S/C22H37F/c1-3-5-7-9-11-13-16-20-17-15-19-22(23)21(20)18-14-12-10-8-6-4-2/h15,17,19H,3-14,16,18H2,1-2H3 |
| InChIKey | ZLXOUSMKPVCRRU-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|