C11H14O — CID 73014071
3-(2,6-dimethylphenyl)propanal (PubChem CID 73014071) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)propanal.
| Compound Name | 3-(2,6-dimethylphenyl)propanal |
|---|---|
| PubChem CID | 73014071 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-(2,6-dimethylphenyl)propanal |
| SMILES | Cc1cccc(C)c1CCC=O |
| InChI | InChI=1S/C11H14O/c1-9-5-3-6-10(2)11(9)7-4-8-12/h3,5-6,8H,4,7H2,1-2H3 |
| InChIKey | FNYPDOIEZBGABA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|