C20H26O — CID 139601622
2-[2-[2-(2,6-dimethylphenyl)ethoxy]ethyl]-1,3-dimethylbenzene (PubChem CID 139601622) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dimethylphenyl)ethoxy]ethyl]-1,3-dimethylbenzene.
| Compound Name | 2-[2-[2-(2,6-dimethylphenyl)ethoxy]ethyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 139601622 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-[2-[2-(2,6-dimethylphenyl)ethoxy]ethyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1CCOCCc1c(C)cccc1C |
| InChI | InChI=1S/C20H26O/c1-15-7-5-8-16(2)19(15)11-13-21-14-12-20-17(3)9-6-10-18(20)4/h5-10H,11-14H2,1-4H3 |
| InChIKey | NNYPOIUTOMRCRW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|