C14H20 — CID 143326143
1,3-dimethyl-2-propylbenzene;prop-1-yne (PubChem CID 143326143) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,3-dimethyl-2-propylbenzene;prop-1-yne.
| Compound Name | 1,3-dimethyl-2-propylbenzene;prop-1-yne |
|---|---|
| PubChem CID | 143326143 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1,3-dimethyl-2-propylbenzene;prop-1-yne |
| SMILES | C#CC.CCCc1c(C)cccc1C |
| InChI | InChI=1S/C11H16.C3H4/c1-4-6-11-9(2)7-5-8-10(11)3;1-3-2/h5,7-8H,4,6H2,1-3H3;1H,2H3 |
| InChIKey | YCEPSLOTMYXJIB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|