About 2-but-2-ynyl-1,3-dimethylbenzene
2-but-2-ynyl-1,3-dimethylbenzene (PubChem CID 173046001) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-but-2-ynyl-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-but-2-ynyl-1,3-dimethylbenzene |
| PubChem CID | 173046001 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-but-2-ynyl-1,3-dimethylbenzene |
| SMILES | CC#CCc1c(C)cccc1C |
| InChI | InChI=1S/C12H14/c1-4-5-9-12-10(2)7-6-8-11(12)3/h6-8H,9H2,1-3H3 |
| InChIKey | UZAUMSDHLQZMQF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-ynyl-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-ynyl-1,3-dimethylbenzene?
The IUPAC name of 2-but-2-ynyl-1,3-dimethylbenzene (CID 173046001) is 2-but-2-ynyl-1,3-dimethylbenzene.
What is the SMILES notation for 2-but-2-ynyl-1,3-dimethylbenzene?
The canonical SMILES for 2-but-2-ynyl-1,3-dimethylbenzene is CC#CCc1c(C)cccc1C.
What is the InChIKey of 2-but-2-ynyl-1,3-dimethylbenzene?
The InChIKey is UZAUMSDHLQZMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14/c1-4-5-9-12-10(2)7-6-8-11(12)3/h6-8H,9H2,1-3H3.
What are the key properties of 2-but-2-ynyl-1,3-dimethylbenzene?
2-but-2-ynyl-1,3-dimethylbenzene has a molecular weight of 158.24 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-ynyl-1,3-dimethylbenzene is sourced from PubChem (CID 173046001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).