C12H14 — CID 173046001
2-but-2-ynyl-1,3-dimethylbenzene (PubChem CID 173046001) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-but-2-ynyl-1,3-dimethylbenzene.
| Compound Name | 2-but-2-ynyl-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 173046001 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-but-2-ynyl-1,3-dimethylbenzene |
| SMILES | CC#CCc1c(C)cccc1C |
| InChI | InChI=1S/C12H14/c1-4-5-9-12-10(2)7-6-8-11(12)3/h6-8H,9H2,1-3H3 |
| InChIKey | UZAUMSDHLQZMQF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|