C10H11NO — CID 13257749
2-(isocyanatomethyl)-1,3-dimethylbenzene (PubChem CID 13257749) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(isocyanatomethyl)-1,3-dimethylbenzene.
| Compound Name | 2-(isocyanatomethyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 13257749 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(isocyanatomethyl)-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1CN=C=O |
| InChI | InChI=1S/C10H11NO/c1-8-4-3-5-9(2)10(8)6-11-7-12/h3-5H,6H2,1-2H3 |
| InChIKey | PHVLTCGZMBJAJO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|