C11H13NO2 — CID 82281358
1-(isocyanatomethyl)-2-methoxy-4,5-dimethylbenzene (PubChem CID 82281358) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(isocyanatomethyl)-2-methoxy-4,5-dimethylbenzene.
| Compound Name | 1-(isocyanatomethyl)-2-methoxy-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 82281358 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1-(isocyanatomethyl)-2-methoxy-4,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C)cc1CN=C=O |
| InChI | InChI=1S/C11H13NO2/c1-8-4-10(6-12-7-13)11(14-3)5-9(8)2/h4-5H,6H2,1-3H3 |
| InChIKey | MXTZECUFARVLOP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|