C11H13NO5S — CID 117430855
1-(isocyanatomethyl)-2,5-dimethoxy-4-methylsulfonylbenzene (PubChem CID 117430855) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-(isocyanatomethyl)-2,5-dimethoxy-4-methylsulfonylbenzene.
| Compound Name | 1-(isocyanatomethyl)-2,5-dimethoxy-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 117430855 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-(isocyanatomethyl)-2,5-dimethoxy-4-methylsulfonylbenzene |
| SMILES | COc1cc(S(C)(=O)=O)c(OC)cc1CN=C=O |
| InChI | InChI=1S/C11H13NO5S/c1-16-9-5-11(18(3,14)15)10(17-2)4-8(9)6-12-7-13/h4-5H,6H2,1-3H3 |
| InChIKey | WIAIOKATPAITGT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|