C10H16N2O4S — CID 116932374
(2,5-dimethoxy-4-methylsulfonylphenyl)methylhydrazine (PubChem CID 116932374) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is (2,5-dimethoxy-4-methylsulfonylphenyl)methylhydrazine.
| Compound Name | (2,5-dimethoxy-4-methylsulfonylphenyl)methylhydrazine |
|---|---|
| PubChem CID | 116932374 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (2,5-dimethoxy-4-methylsulfonylphenyl)methylhydrazine |
| SMILES | COc1cc(S(C)(=O)=O)c(OC)cc1CNN |
| InChI | InChI=1S/C10H16N2O4S/c1-15-8-5-10(17(3,13)14)9(16-2)4-7(8)6-12-11/h4-5,12H,6,11H2,1-3H3 |
| InChIKey | RWMGQRUCKDPTSB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|