C12H19NO4S — CID 117436174
3-(4,5-dimethoxy-2-methylsulfonylphenyl)propan-1-amine (PubChem CID 117436174) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-methylsulfonylphenyl)propan-1-amine.
| Compound Name | 3-(4,5-dimethoxy-2-methylsulfonylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117436174 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-(4,5-dimethoxy-2-methylsulfonylphenyl)propan-1-amine |
| SMILES | COc1cc(CCCN)c(S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C12H19NO4S/c1-16-10-7-9(5-4-6-13)12(18(3,14)15)8-11(10)17-2/h7-8H,4-6,13H2,1-3H3 |
| InChIKey | NFWLKZPSHPWQAI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |