C13H20N2O5S — CID 174787253
(2,5-diethoxy-4-methylsulfonylphenyl)methylurea (PubChem CID 174787253) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2,5-diethoxy-4-methylsulfonylphenyl)methylurea.
| Compound Name | (2,5-diethoxy-4-methylsulfonylphenyl)methylurea |
|---|---|
| PubChem CID | 174787253 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2,5-diethoxy-4-methylsulfonylphenyl)methylurea |
| SMILES | CCOc1cc(S(C)(=O)=O)c(OCC)cc1CNC(N)=O |
| InChI | InChI=1S/C13H20N2O5S/c1-4-19-10-7-12(21(3,17)18)11(20-5-2)6-9(10)8-15-13(14)16/h6-7H,4-5,8H2,1-3H3,(H3,14,15,16) |
| InChIKey | WUCGEOJDALWFQV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |