C14H22N2O2 — CID 115168787
[2-(4-ethoxy-3-methylphenyl)-2-methylpropyl]urea (PubChem CID 115168787) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [2-(4-ethoxy-3-methylphenyl)-2-methylpropyl]urea.
| Compound Name | [2-(4-ethoxy-3-methylphenyl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 115168787 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [2-(4-ethoxy-3-methylphenyl)-2-methylpropyl]urea |
| SMILES | CCOc1ccc(C(C)(C)CNC(N)=O)cc1C |
| InChI | InChI=1S/C14H22N2O2/c1-5-18-12-7-6-11(8-10(12)2)14(3,4)9-16-13(15)17/h6-8H,5,9H2,1-4H3,(H3,15,16,17) |
| InChIKey | FJEVEJIDBGPAKB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |