C15H24N2O2 — CID 115168853
[2-(4-methoxy-2,3,6-trimethylphenyl)-2-methylpropyl]urea (PubChem CID 115168853) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [2-(4-methoxy-2,3,6-trimethylphenyl)-2-methylpropyl]urea.
| Compound Name | [2-(4-methoxy-2,3,6-trimethylphenyl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 115168853 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [2-(4-methoxy-2,3,6-trimethylphenyl)-2-methylpropyl]urea |
| SMILES | COc1cc(C)c(C(C)(C)CNC(N)=O)c(C)c1C |
| InChI | InChI=1S/C15H24N2O2/c1-9-7-12(19-6)10(2)11(3)13(9)15(4,5)8-17-14(16)18/h7H,8H2,1-6H3,(H3,16,17,18) |
| InChIKey | YUBCFVDZNUFBCF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |