C11H13F3O — CID 116964846
1-methoxy-2,3,5-trimethyl-4-(trifluoromethyl)benzene (PubChem CID 116964846) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-methoxy-2,3,5-trimethyl-4-(trifluoromethyl)benzene.
| Compound Name | 1-methoxy-2,3,5-trimethyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 116964846 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-methoxy-2,3,5-trimethyl-4-(trifluoromethyl)benzene |
| SMILES | COc1cc(C)c(C(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C11H13F3O/c1-6-5-9(15-4)7(2)8(3)10(6)11(12,13)14/h5H,1-4H3 |
| InChIKey | NGKSJKVEYWHQCM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |