C10H8F6O — CID 74891112
1-methoxy-2-methyl-3,5-bis(trifluoromethyl)benzene (PubChem CID 74891112) has the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. Its IUPAC name is 1-methoxy-2-methyl-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-methoxy-2-methyl-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 74891112 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-methoxy-2-methyl-3,5-bis(trifluoromethyl)benzene |
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1C |
| InChI | InChI=1S/C10H8F6O/c1-5-7(10(14,15)16)3-6(9(11,12)13)4-8(5)17-2/h3-4H,1-2H3 |
| InChIKey | FONITQGJROZTTK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |