C14H17F6NO — CID 171234272
(1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]pentan-1-amine (PubChem CID 171234272) has the molecular formula C14H17F6NO and a molecular weight of 329.28 g/mol. Its IUPAC name is (1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]pentan-1-amine.
| Compound Name | (1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]pentan-1-amine |
|---|---|
| PubChem CID | 171234272 |
| Molecular Formula | C14H17F6NO |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (1S)-1-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]pentan-1-amine |
| SMILES | CCCC[C@H](N)c1c(OC)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17F6NO/c1-3-4-5-10(21)12-9(14(18,19)20)6-8(13(15,16)17)7-11(12)22-2/h6-7,10H,3-5,21H2,1-2H3/t10-/m0/s1 |
| InChIKey | NOCFTPGYBMQCJJ-JTQLQIEISA-N |
| XLogP | 4.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |