C13H15F7N2 — CID 171235749
(1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentane-1,5-diamine (PubChem CID 171235749) has the molecular formula C13H15F7N2 and a molecular weight of 332.26 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentane-1,5-diamine.
| Compound Name | (1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 171235749 |
| Molecular Formula | C13H15F7N2 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1c(F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F7N2/c14-9-6-7(12(15,16)17)5-8(13(18,19)20)11(9)10(22)3-1-2-4-21/h5-6,10H,1-4,21-22H2/t10-/m0/s1 |
| InChIKey | XHKWPBMXOVGBCJ-JTQLQIEISA-N |
| XLogP | 3.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|