C13H14F7NO — CID 171271722
(1S,2R)-1-amino-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 171271722) has the molecular formula C13H14F7NO and a molecular weight of 333.25 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 171271722 |
| Molecular Formula | C13H14F7NO |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (1S,2R)-1-amino-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](N)c1c(F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F7NO/c1-2-3-9(22)11(21)10-7(13(18,19)20)4-6(5-8(10)14)12(15,16)17/h4-5,9,11,22H,2-3,21H2,1H3/t9-,11-/m1/s1 |
| InChIKey | HXYWDCCALZHSKH-MWLCHTKSSA-N |
| XLogP | 4.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |