C13H15F6NO — CID 171263740
(1R,2S)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 171263740) has the molecular formula C13H15F6NO and a molecular weight of 315.26 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 171263740 |
| Molecular Formula | C13H15F6NO |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (1R,2S)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | CCC[C@H](O)[C@H](N)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H15F6NO/c1-2-3-10(21)11(20)8-6-7(12(14,15)16)4-5-9(8)13(17,18)19/h4-6,10-11,21H,2-3,20H2,1H3/t10-,11+/m0/s1 |
| InChIKey | CJTNUYYGEVVDOL-WDEREUQCSA-N |
| XLogP | 3.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |