C12H15F4NO — CID 171269084
(1S,2R)-1-amino-1-[2-fluoro-3-(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 171269084) has the molecular formula C12H15F4NO and a molecular weight of 265.25 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-[2-fluoro-3-(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-[2-fluoro-3-(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 171269084 |
| Molecular Formula | C12H15F4NO |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1S,2R)-1-amino-1-[2-fluoro-3-(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](N)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H15F4NO/c1-2-4-9(18)11(17)7-5-3-6-8(10(7)13)12(14,15)16/h3,5-6,9,11,18H,2,4,17H2,1H3/t9-,11+/m1/s1 |
| InChIKey | CRLZLYJIXPUVKG-KOLCDFICSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |