C12H16BrF3N2 — CID 171226710
(1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]pentane-1,5-diamine (PubChem CID 171226710) has the molecular formula C12H16BrF3N2 and a molecular weight of 325.17 g/mol. Its IUPAC name is (1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]pentane-1,5-diamine.
| Compound Name | (1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 171226710 |
| Molecular Formula | C12H16BrF3N2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (1S)-1-[3-bromo-5-(trifluoromethyl)phenyl]pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16BrF3N2/c13-10-6-8(11(18)3-1-2-4-17)5-9(7-10)12(14,15)16/h5-7,11H,1-4,17-18H2/t11-/m0/s1 |
| InChIKey | NLWGKHGDXYVEAM-NSHDSACASA-N |
| XLogP | 3.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|