C12H16BrF3N2O — CID 171227830
(1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]pentane-1,5-diamine (PubChem CID 171227830) has the molecular formula C12H16BrF3N2O and a molecular weight of 341.17 g/mol. Its IUPAC name is (1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]pentane-1,5-diamine.
| Compound Name | (1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 171227830 |
| Molecular Formula | C12H16BrF3N2O |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | (1S)-1-[3-bromo-5-(trifluoromethoxy)phenyl]pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1cc(Br)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16BrF3N2O/c13-9-5-8(11(18)3-1-2-4-17)6-10(7-9)19-12(14,15)16/h5-7,11H,1-4,17-18H2/t11-/m0/s1 |
| InChIKey | MBHOPHYNSLOFAX-NSHDSACASA-N |
| XLogP | 3.48 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|