C11H11BrF3NO2 — CID 117116026
4-amino-4-[3-bromo-5-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 117116026) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 4-amino-4-[3-bromo-5-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[3-bromo-5-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117116026 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-amino-4-[3-bromo-5-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11BrF3NO2/c12-8-4-6(9(16)1-2-10(17)18)3-7(5-8)11(13,14)15/h3-5,9H,1-2,16H2,(H,17,18) |
| InChIKey | IJTIAAWDJFUONC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |