C12H13ClF3NO3 — CID 117496404
4-amino-4-[3-chloro-4-methoxy-5-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 117496404) has the molecular formula C12H13ClF3NO3 and a molecular weight of 311.69 g/mol. Its IUPAC name is 4-amino-4-[3-chloro-4-methoxy-5-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[3-chloro-4-methoxy-5-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117496404 |
| Molecular Formula | C12H13ClF3NO3 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-amino-4-[3-chloro-4-methoxy-5-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | COc1c(Cl)cc(C(N)CCC(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13ClF3NO3/c1-20-11-7(12(14,15)16)4-6(5-8(11)13)9(17)2-3-10(18)19/h4-5,9H,2-3,17H2,1H3,(H,18,19) |
| InChIKey | ASPRRBFHJFPASJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |